C10H21NOS — CID 20780776
S-methyl N,N-bis(2-methylpropyl)carbamothioate (PubChem CID 20780776) has the molecular formula C10H21NOS and a molecular weight of 203.35 g/mol. Its IUPAC name is S-methyl N,N-bis(2-methylpropyl)carbamothioate.
| Compound Name | S-methyl N,N-bis(2-methylpropyl)carbamothioate |
|---|---|
| PubChem CID | 20780776 |
| Molecular Formula | C10H21NOS |
| Molecular Weight | 203.35 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | S-methyl N,N-bis(2-methylpropyl)carbamothioate |
| SMILES | CSC(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C10H21NOS/c1-8(2)6-11(7-9(3)4)10(12)13-5/h8-9H,6-7H2,1-5H3 |
| InChIKey | UIWYKODGYXDAAF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|