C11H21NO3S — CID 115730558
2-[(2-methyl-3-methylsulfanylpropanoyl)-(2-methylpropyl)amino]acetic acid (PubChem CID 115730558) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is 2-[(2-methyl-3-methylsulfanylpropanoyl)-(2-methylpropyl)amino]acetic acid.
| Compound Name | 2-[(2-methyl-3-methylsulfanylpropanoyl)-(2-methylpropyl)amino]acetic acid |
|---|---|
| PubChem CID | 115730558 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-[(2-methyl-3-methylsulfanylpropanoyl)-(2-methylpropyl)amino]acetic acid |
| SMILES | CSCC(C)C(=O)N(CC(=O)O)CC(C)C |
| InChI | InChI=1S/C11H21NO3S/c1-8(2)5-12(6-10(13)14)11(15)9(3)7-16-4/h8-9H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | JCRGSTZZHSDTSZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |