C11H23NOSTi — CID 87157632
S-ethyl N,N-bis(2-methylpropyl)carbamothioate;titanium (PubChem CID 87157632) has the molecular formula C11H23NOSTi and a molecular weight of 265.25 g/mol. Its IUPAC name is S-ethyl N,N-bis(2-methylpropyl)carbamothioate;titanium.
| Compound Name | S-ethyl N,N-bis(2-methylpropyl)carbamothioate;titanium |
|---|---|
| PubChem CID | 87157632 |
| Molecular Formula | C11H23NOSTi |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | S-ethyl N,N-bis(2-methylpropyl)carbamothioate;titanium |
| SMILES | CCSC(=O)N(CC(C)C)CC(C)C.[Ti] |
| InChI | InChI=1S/C11H23NOS.Ti/c1-6-14-11(13)12(7-9(2)3)8-10(4)5;/h9-10H,6-8H2,1-5H3; |
| InChIKey | KBIYXLFHZYFHLB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|