C21H45N3O3S3 — CID 88676434
carbamothioic S-acid;S-ethyl N,N-bis(2-methylpropyl)carbamothioate;S-ethyl N,N-dipropylcarbamothioate (PubChem CID 88676434) has the molecular formula C21H45N3O3S3 and a molecular weight of 483.81 g/mol. Its IUPAC name is carbamothioic S-acid;S-ethyl N,N-bis(2-methylpropyl)carbamothioate;S-ethyl N,N-dipropylcarbamothioate.
| Compound Name | carbamothioic S-acid;S-ethyl N,N-bis(2-methylpropyl)carbamothioate;S-ethyl N,N-dipropylcarbamothioate |
|---|---|
| PubChem CID | 88676434 |
| Molecular Formula | C21H45N3O3S3 |
| Molecular Weight | 483.81 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | carbamothioic S-acid;S-ethyl N,N-bis(2-methylpropyl)carbamothioate;S-ethyl N,N-dipropylcarbamothioate |
| SMILES | CCCN(CCC)C(=O)SCC.CCSC(=O)N(CC(C)C)CC(C)C.NC(=O)S |
| InChI | InChI=1S/C11H23NOS.C9H19NOS.CH3NOS/c1-6-14-11(13)12(7-9(2)3)8-10(4)5;1-4-7-10(8-5-2)9(11)12-6-3;2-1(3)4/h9-10H,6-8H2,1-5H3;4-8H2,1-3H3;(H3,2,3,4) |
| InChIKey | IXTTYHXGXUDKFG-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.81 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|