C15H33NO3S — CID 87080557
2-ethoxyethanol;S-ethyl N,N-bis(2-methylpropyl)carbamothioate (PubChem CID 87080557) has the molecular formula C15H33NO3S and a molecular weight of 307.50 g/mol. Its IUPAC name is 2-ethoxyethanol;S-ethyl N,N-bis(2-methylpropyl)carbamothioate.
| Compound Name | 2-ethoxyethanol;S-ethyl N,N-bis(2-methylpropyl)carbamothioate |
|---|---|
| PubChem CID | 87080557 |
| Molecular Formula | C15H33NO3S |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | 2-ethoxyethanol;S-ethyl N,N-bis(2-methylpropyl)carbamothioate |
| SMILES | CCOCCO.CCSC(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C11H23NOS.C4H10O2/c1-6-14-11(13)12(7-9(2)3)8-10(4)5;1-2-6-4-3-5/h9-10H,6-8H2,1-5H3;5H,2-4H2,1H3 |
| InChIKey | DPVBSNZYXWCWPI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|