C15H31NO4S — CID 139485074
S-ethyl N,N-bis(2-methylpropyl)carbamothioate;2-hydroxyethyl acetate (PubChem CID 139485074) has the molecular formula C15H31NO4S and a molecular weight of 321.48 g/mol. Its IUPAC name is S-ethyl N,N-bis(2-methylpropyl)carbamothioate;2-hydroxyethyl acetate.
| Compound Name | S-ethyl N,N-bis(2-methylpropyl)carbamothioate;2-hydroxyethyl acetate |
|---|---|
| PubChem CID | 139485074 |
| Molecular Formula | C15H31NO4S |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | S-ethyl N,N-bis(2-methylpropyl)carbamothioate;2-hydroxyethyl acetate |
| SMILES | CC(=O)OCCO.CCSC(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C11H23NOS.C4H8O3/c1-6-14-11(13)12(7-9(2)3)8-10(4)5;1-4(6)7-3-2-5/h9-10H,6-8H2,1-5H3;5H,2-3H2,1H3 |
| InChIKey | DFZXCRLULOKUEO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|