C13H27NOS — CID 87296608
ethene;S-ethyl N,N-bis(2-methylpropyl)carbamothioate (PubChem CID 87296608) has the molecular formula C13H27NOS and a molecular weight of 245.43 g/mol. Its IUPAC name is ethene;S-ethyl N,N-bis(2-methylpropyl)carbamothioate.
| Compound Name | ethene;S-ethyl N,N-bis(2-methylpropyl)carbamothioate |
|---|---|
| PubChem CID | 87296608 |
| Molecular Formula | C13H27NOS |
| Molecular Weight | 245.43 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | ethene;S-ethyl N,N-bis(2-methylpropyl)carbamothioate |
| SMILES | C=C.CCSC(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C11H23NOS.C2H4/c1-6-14-11(13)12(7-9(2)3)8-10(4)5;1-2/h9-10H,6-8H2,1-5H3;1-2H2 |
| InChIKey | GPPHJJWMSKSBFV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|