C19H39NO7S — CID 87080572
2-acetyloxyethyl acetate;ethane-1,2-diol;S-ethyl N,N-bis(2-methylpropyl)carbamothioate (PubChem CID 87080572) has the molecular formula C19H39NO7S and a molecular weight of 425.59 g/mol. Its IUPAC name is 2-acetyloxyethyl acetate;ethane-1,2-diol;S-ethyl N,N-bis(2-methylpropyl)carbamothioate.
| Compound Name | 2-acetyloxyethyl acetate;ethane-1,2-diol;S-ethyl N,N-bis(2-methylpropyl)carbamothioate |
|---|---|
| PubChem CID | 87080572 |
| Molecular Formula | C19H39NO7S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 2-acetyloxyethyl acetate;ethane-1,2-diol;S-ethyl N,N-bis(2-methylpropyl)carbamothioate |
| SMILES | CC(=O)OCCOC(C)=O.CCSC(=O)N(CC(C)C)CC(C)C.OCCO |
| InChI | InChI=1S/C11H23NOS.C6H10O4.C2H6O2/c1-6-14-11(13)12(7-9(2)3)8-10(4)5;1-5(7)9-3-4-10-6(2)8;3-1-2-4/h9-10H,6-8H2,1-5H3;3-4H2,1-2H3;3-4H,1-2H2 |
| InChIKey | GEHWSXPJUBLPTD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|