C13H29NOS — CID 88766037
butane;S-ethyl N,N-dipropylcarbamothioate (PubChem CID 88766037) has the molecular formula C13H29NOS and a molecular weight of 247.45 g/mol. Its IUPAC name is butane;S-ethyl N,N-dipropylcarbamothioate.
| Compound Name | butane;S-ethyl N,N-dipropylcarbamothioate |
|---|---|
| PubChem CID | 88766037 |
| Molecular Formula | C13H29NOS |
| Molecular Weight | 247.45 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | butane;S-ethyl N,N-dipropylcarbamothioate |
| SMILES | CCCC.CCCN(CCC)C(=O)SCC |
| InChI | InChI=1S/C9H19NOS.C4H10/c1-4-7-10(8-5-2)9(11)12-6-3;1-3-4-2/h4-8H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | DJQRRJGZTIRZTP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|