C18H39N2O2S2+ — CID 172681056
S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium (PubChem CID 172681056) has the molecular formula C18H39N2O2S2+ and a molecular weight of 379.66 g/mol. Its IUPAC name is S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium.
| Compound Name | S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium |
|---|---|
| PubChem CID | 172681056 |
| Molecular Formula | C18H39N2O2S2+ |
| Molecular Weight | 379.66 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium |
| SMILES | CCCN(CCC)C(=O)SCC.CCC[N+](CCC)=C(O)SCC |
| InChI | InChI=1S/2C9H19NOS/c2*1-4-7-10(8-5-2)9(11)12-6-3/h2*4-8H2,1-3H3/p+1 |
| InChIKey | AKCVIKFDVSLAHF-UHFFFAOYSA-O |
| XLogP | 5.47 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|