About S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium
S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium (PubChem CID 172681056) has the molecular formula C18H39N2O2S2+
and a molecular weight of 379.66 g/mol. Its IUPAC name is S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium.
Molecular Properties
| Compound Name | S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium |
| PubChem CID | 172681056 |
| Molecular Formula | C18H39N2O2S2+ |
| Molecular Weight | 379.66 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium |
| SMILES | CCCN(CCC)C(=O)SCC.CCC[N+](CCC)=C(O)SCC |
| InChI | InChI=1S/2C9H19NOS/c2*1-4-7-10(8-5-2)9(11)12-6-3/h2*4-8H2,1-3H3/p+1 |
| InChIKey | AKCVIKFDVSLAHF-UHFFFAOYSA-O |
| XLogP | 5.47 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium?
The IUPAC name of S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium (CID 172681056) is S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium.
What is the SMILES notation for S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium?
The canonical SMILES for S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium is CCCN(CCC)C(=O)SCC.CCC[N+](CCC)=C(O)SCC.
What is the InChIKey of S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium?
The InChIKey is AKCVIKFDVSLAHF-UHFFFAOYSA-O. The full InChI is InChI=1S/2C9H19NOS/c2*1-4-7-10(8-5-2)9(11)12-6-3/h2*4-8H2,1-3H3/p+1.
What are the key properties of S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium?
S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium has a molecular weight of 379.66 g/mol, XLogP of 5.47, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl N,N-dipropylcarbamothioate;[ethylsulfanyl(hydroxy)methylidene]-dipropylazanium is sourced from PubChem (CID 172681056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).