C13H28N2O2 — CID 60546714
3-(3-methoxypropyl)-1,1-bis(2-methylpropyl)urea (PubChem CID 60546714) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-1,1-bis(2-methylpropyl)urea.
| Compound Name | 3-(3-methoxypropyl)-1,1-bis(2-methylpropyl)urea |
|---|---|
| PubChem CID | 60546714 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 3-(3-methoxypropyl)-1,1-bis(2-methylpropyl)urea |
| SMILES | COCCCNC(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C13H28N2O2/c1-11(2)9-15(10-12(3)4)13(16)14-7-6-8-17-5/h11-12H,6-10H2,1-5H3,(H,14,16) |
| InChIKey | NEAZXTWGYUISQU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|