C14H29N3O2 — CID 108529511
N-[2-(dimethylamino)ethyl]-N',N'-bis(2-methylpropyl)oxamide (PubChem CID 108529511) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N',N'-bis(2-methylpropyl)oxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N',N'-bis(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 108529511 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N',N'-bis(2-methylpropyl)oxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)C(=O)NCCN(C)C |
| InChI | InChI=1S/C14H29N3O2/c1-11(2)9-17(10-12(3)4)14(19)13(18)15-7-8-16(5)6/h11-12H,7-10H2,1-6H3,(H,15,18) |
| InChIKey | CMJBSVLMSXMXLE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|