C24H50N2O — CID 21297929
N-[2-(dimethylamino)ethyl]-3,7,11,15-tetramethylhexadecanamide (PubChem CID 21297929) has the molecular formula C24H50N2O and a molecular weight of 382.68 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3,7,11,15-tetramethylhexadecanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3,7,11,15-tetramethylhexadecanamide |
|---|---|
| PubChem CID | 21297929 |
| Molecular Formula | C24H50N2O |
| Molecular Weight | 382.68 g/mol |
| Exact Mass | 382.39 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3,7,11,15-tetramethylhexadecanamide |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)NCCN(C)C |
| InChI | InChI=1S/C24H50N2O/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-16-23(5)19-24(27)25-17-18-26(6)7/h20-23H,8-19H2,1-7H3,(H,25,27) |
| InChIKey | RZYYJIROTCUDOH-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.68 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |