C9H20N4O2 — CID 58987538
(2S)-2-amino-N'-[2-(dimethylamino)ethyl]pentanediamide (PubChem CID 58987538) has the molecular formula C9H20N4O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (2S)-2-amino-N'-[2-(dimethylamino)ethyl]pentanediamide.
| Compound Name | (2S)-2-amino-N'-[2-(dimethylamino)ethyl]pentanediamide |
|---|---|
| PubChem CID | 58987538 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (2S)-2-amino-N'-[2-(dimethylamino)ethyl]pentanediamide |
| SMILES | CN(C)CCNC(=O)CC[C@H](N)C(N)=O |
| InChI | InChI=1S/C9H20N4O2/c1-13(2)6-5-12-8(14)4-3-7(10)9(11)15/h7H,3-6,10H2,1-2H3,(H2,11,15)(H,12,14)/t7-/m0/s1 |
| InChIKey | UHLBABPFUVZBMS-ZETCQYMHSA-N |
| XLogP | -1.74 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |