C13H19N3O2 — CID 58987488
(2S)-2-amino-N'-(2-phenylethyl)pentanediamide (PubChem CID 58987488) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is (2S)-2-amino-N'-(2-phenylethyl)pentanediamide.
| Compound Name | (2S)-2-amino-N'-(2-phenylethyl)pentanediamide |
|---|---|
| PubChem CID | 58987488 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (2S)-2-amino-N'-(2-phenylethyl)pentanediamide |
| SMILES | NC(=O)[C@@H](N)CCC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C13H19N3O2/c14-11(13(15)18)6-7-12(17)16-9-8-10-4-2-1-3-5-10/h1-5,11H,6-9,14H2,(H2,15,18)(H,16,17)/t11-/m0/s1 |
| InChIKey | KBJAAQKASOPKOG-NSHDSACASA-N |
| XLogP | -0.06 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |