C12H17N3O3 — CID 69303223
(2S)-2-amino-5-oxo-5-(2-pyridin-2-ylethylamino)pentanoic acid (PubChem CID 69303223) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is (2S)-2-amino-5-oxo-5-(2-pyridin-2-ylethylamino)pentanoic acid.
| Compound Name | (2S)-2-amino-5-oxo-5-(2-pyridin-2-ylethylamino)pentanoic acid |
|---|---|
| PubChem CID | 69303223 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (2S)-2-amino-5-oxo-5-(2-pyridin-2-ylethylamino)pentanoic acid |
| SMILES | N[C@@H](CCC(=O)NCCc1ccccn1)C(=O)O |
| InChI | InChI=1S/C12H17N3O3/c13-10(12(17)18)4-5-11(16)15-8-6-9-3-1-2-7-14-9/h1-3,7,10H,4-6,8,13H2,(H,15,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | AJGOCPBJAHKFDK-JTQLQIEISA-N |
| XLogP | -0.07 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |