C15H24N4O2 — CID 131857193
(2S)-2-amino-N-[2-oxo-2-(2-pyridin-2-ylethylamino)ethyl]hexanamide (PubChem CID 131857193) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-oxo-2-(2-pyridin-2-ylethylamino)ethyl]hexanamide.
| Compound Name | (2S)-2-amino-N-[2-oxo-2-(2-pyridin-2-ylethylamino)ethyl]hexanamide |
|---|---|
| PubChem CID | 131857193 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (2S)-2-amino-N-[2-oxo-2-(2-pyridin-2-ylethylamino)ethyl]hexanamide |
| SMILES | CCCC[C@H](N)C(=O)NCC(=O)NCCc1ccccn1 |
| InChI | InChI=1S/C15H24N4O2/c1-2-3-7-13(16)15(21)19-11-14(20)18-10-8-12-6-4-5-9-17-12/h4-6,9,13H,2-3,7-8,10-11,16H2,1H3,(H,18,20)(H,19,21)/t13-/m0/s1 |
| InChIKey | QCFGUUZWAKJRPP-ZDUSSCGKSA-N |
| XLogP | 0.37 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |