C18H20N4O4 — CID 70137624
2-amino-3-oxo-3-[[2-oxo-2-(2-pyridin-2-ylethylamino)ethyl]amino]-2-phenylpropanoic acid (PubChem CID 70137624) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-amino-3-oxo-3-[[2-oxo-2-(2-pyridin-2-ylethylamino)ethyl]amino]-2-phenylpropanoic acid.
| Compound Name | 2-amino-3-oxo-3-[[2-oxo-2-(2-pyridin-2-ylethylamino)ethyl]amino]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 70137624 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-amino-3-oxo-3-[[2-oxo-2-(2-pyridin-2-ylethylamino)ethyl]amino]-2-phenylpropanoic acid |
| SMILES | NC(C(=O)O)(C(=O)NCC(=O)NCCc1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C18H20N4O4/c19-18(17(25)26,13-6-2-1-3-7-13)16(24)22-12-15(23)21-11-9-14-8-4-5-10-20-14/h1-8,10H,9,11-12,19H2,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | DARGLYPUNKRQGH-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|