C13H14N2OS — CID 32623668
N-(2-pyridin-2-ylethyl)-2-thiophen-3-ylacetamide (PubChem CID 32623668) has the molecular formula C13H14N2OS and a molecular weight of 246.34 g/mol. Its IUPAC name is N-(2-pyridin-2-ylethyl)-2-thiophen-3-ylacetamide.
| Compound Name | N-(2-pyridin-2-ylethyl)-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 32623668 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | N-(2-pyridin-2-ylethyl)-2-thiophen-3-ylacetamide |
| SMILES | O=C(Cc1ccsc1)NCCc1ccccn1 |
| InChI | InChI=1S/C13H14N2OS/c16-13(9-11-5-8-17-10-11)15-7-4-12-3-1-2-6-14-12/h1-3,5-6,8,10H,4,7,9H2,(H,15,16) |
| InChIKey | TXNVUEHDLTXUAE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |