C15H29NaO2 — CID 23693334
sodium 3,7,11-trimethyldodecanoate (PubChem CID 23693334) has the molecular formula C15H29NaO2 and a molecular weight of 264.38 g/mol. Its IUPAC name is sodium 3,7,11-trimethyldodecanoate.
| Compound Name | sodium 3,7,11-trimethyldodecanoate |
|---|---|
| PubChem CID | 23693334 |
| Molecular Formula | C15H29NaO2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | sodium 3,7,11-trimethyldodecanoate |
| SMILES | CC(C)CCCC(C)CCCC(C)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C15H30O2.Na/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17;/h12-14H,5-11H2,1-4H3,(H,16,17);/q;+1/p-1 |
| InChIKey | NUEPCQRKZOOQMS-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |