sodium 3,7,11-trimethyldodecanoate

C15H29NaO2 — CID 23693334

IUPACsodium 3,7,11-trimethyldodecanoate
SMILESCC(C)CCCC(C)CCCC(C)CC(=O)[O-].[Na+]
InChIInChI=1S/C15H30O2.Na/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17;/h12-14H,5-11H2,1-4H3,(H,16,17);/q;+1/p-1
InChIKeyNUEPCQRKZOOQMS-UHFFFAOYSA-M
MW264.38 g/mol
LogP0.40
Rot. Bonds10

About sodium 3,7,11-trimethyldodecanoate

sodium 3,7,11-trimethyldodecanoate (PubChem CID 23693334) has the molecular formula C15H29NaO2 and a molecular weight of 264.38 g/mol. Its IUPAC name is sodium 3,7,11-trimethyldodecanoate.

Molecular Properties

Compound Namesodium 3,7,11-trimethyldodecanoate
PubChem CID23693334
Molecular FormulaC15H29NaO2
Molecular Weight264.38 g/mol
Exact Mass264.21
IUPAC Namesodium 3,7,11-trimethyldodecanoate
SMILESCC(C)CCCC(C)CCCC(C)CC(=O)[O-].[Na+]
InChIInChI=1S/C15H30O2.Na/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17;/h12-14H,5-11H2,1-4H3,(H,16,17);/q;+1/p-1
InChIKeyNUEPCQRKZOOQMS-UHFFFAOYSA-M
XLogP0.40
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.38
LogP ≤ 50.40
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze sodium 3,7,11-trimethyldodecanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 3,7,11-trimethyldodecanoate?
The IUPAC name of sodium 3,7,11-trimethyldodecanoate (CID 23693334) is sodium 3,7,11-trimethyldodecanoate.
What is the SMILES notation for sodium 3,7,11-trimethyldodecanoate?
The canonical SMILES for sodium 3,7,11-trimethyldodecanoate is CC(C)CCCC(C)CCCC(C)CC(=O)[O-].[Na+].
What is the InChIKey of sodium 3,7,11-trimethyldodecanoate?
The InChIKey is NUEPCQRKZOOQMS-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H30O2.Na/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17;/h12-14H,5-11H2,1-4H3,(H,16,17);/q;+1/p-1.
What are the key properties of sodium 3,7,11-trimethyldodecanoate?
sodium 3,7,11-trimethyldodecanoate has a molecular weight of 264.38 g/mol, XLogP of 0.40, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3,7,11-trimethyldodecanoate is sourced from PubChem (CID 23693334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).