C20H39O3- — CID 86290131
16-hydroxy-3,7,11,15-tetramethylhexadecanoate (PubChem CID 86290131) has the molecular formula C20H39O3- and a molecular weight of 327.53 g/mol. Its IUPAC name is 16-hydroxy-3,7,11,15-tetramethylhexadecanoate.
| Compound Name | 16-hydroxy-3,7,11,15-tetramethylhexadecanoate |
|---|---|
| PubChem CID | 86290131 |
| Molecular Formula | C20H39O3- |
| Molecular Weight | 327.53 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | 16-hydroxy-3,7,11,15-tetramethylhexadecanoate |
| SMILES | CC(CO)CCCC(C)CCCC(C)CCCC(C)CC(=O)[O-] |
| InChI | InChI=1S/C20H40O3/c1-16(10-6-12-18(3)14-20(22)23)8-5-9-17(2)11-7-13-19(4)15-21/h16-19,21H,5-15H2,1-4H3,(H,22,23)/p-1 |
| InChIKey | CBZPGRKSSXCZLI-UHFFFAOYSA-M |
| XLogP | 4.17 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |