C20H34Cl2N2O4 — CID 90278062
6-[[6-[(5-chloro-5-oxopentanoyl)amino]-3,3,5-trimethylhexyl]amino]-6-oxohexanoyl chloride (PubChem CID 90278062) has the molecular formula C20H34Cl2N2O4 and a molecular weight of 437.41 g/mol. Its IUPAC name is 6-[[6-[(5-chloro-5-oxopentanoyl)amino]-3,3,5-trimethylhexyl]amino]-6-oxohexanoyl chloride.
| Compound Name | 6-[[6-[(5-chloro-5-oxopentanoyl)amino]-3,3,5-trimethylhexyl]amino]-6-oxohexanoyl chloride |
|---|---|
| PubChem CID | 90278062 |
| Molecular Formula | C20H34Cl2N2O4 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 6-[[6-[(5-chloro-5-oxopentanoyl)amino]-3,3,5-trimethylhexyl]amino]-6-oxohexanoyl chloride |
| SMILES | CC(CNC(=O)CCCC(=O)Cl)CC(C)(C)CCNC(=O)CCCCC(=O)Cl |
| InChI | InChI=1S/C20H34Cl2N2O4/c1-15(14-24-19(28)10-6-8-17(22)26)13-20(2,3)11-12-23-18(27)9-5-4-7-16(21)25/h15H,4-14H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | KHWSDIFJABORRQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|