C18H37NO — CID 155456074
3,3-dimethyl-N-(2,4,4,5-tetramethylhexyl)hexanamide (PubChem CID 155456074) has the molecular formula C18H37NO and a molecular weight of 283.50 g/mol. Its IUPAC name is 3,3-dimethyl-N-(2,4,4,5-tetramethylhexyl)hexanamide.
| Compound Name | 3,3-dimethyl-N-(2,4,4,5-tetramethylhexyl)hexanamide |
|---|---|
| PubChem CID | 155456074 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | 3,3-dimethyl-N-(2,4,4,5-tetramethylhexyl)hexanamide |
| SMILES | CCCC(C)(C)CC(=O)NCC(C)CC(C)(C)C(C)C |
| InChI | InChI=1S/C18H37NO/c1-9-10-17(5,6)12-16(20)19-13-15(4)11-18(7,8)14(2)3/h14-15H,9-13H2,1-8H3,(H,19,20) |
| InChIKey | QYYODANBFMZKKM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |