C24H48N2O2 — CID 167176337
3,5,5,6-tetramethyl-N-[2-(3,3,5-trimethylhexanoylamino)butan-2-yl]heptanamide (PubChem CID 167176337) has the molecular formula C24H48N2O2 and a molecular weight of 396.66 g/mol. Its IUPAC name is 3,5,5,6-tetramethyl-N-[2-(3,3,5-trimethylhexanoylamino)butan-2-yl]heptanamide.
| Compound Name | 3,5,5,6-tetramethyl-N-[2-(3,3,5-trimethylhexanoylamino)butan-2-yl]heptanamide |
|---|---|
| PubChem CID | 167176337 |
| Molecular Formula | C24H48N2O2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.37 |
| IUPAC Name | 3,5,5,6-tetramethyl-N-[2-(3,3,5-trimethylhexanoylamino)butan-2-yl]heptanamide |
| SMILES | CCC(C)(NC(=O)CC(C)CC(C)(C)C(C)C)NC(=O)CC(C)(C)CC(C)C |
| InChI | InChI=1S/C24H48N2O2/c1-12-24(11,26-21(28)16-22(7,8)14-17(2)3)25-20(27)13-19(6)15-23(9,10)18(4)5/h17-19H,12-16H2,1-11H3,(H,25,27)(H,26,28) |
| InChIKey | YVUSZIVUQQNZHQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|