C10H17ClO2 — CID 88803319
4,4,6-trimethyl-2-oxoheptanoyl chloride (PubChem CID 88803319) has the molecular formula C10H17ClO2 and a molecular weight of 204.70 g/mol. Its IUPAC name is 4,4,6-trimethyl-2-oxoheptanoyl chloride.
| Compound Name | 4,4,6-trimethyl-2-oxoheptanoyl chloride |
|---|---|
| PubChem CID | 88803319 |
| Molecular Formula | C10H17ClO2 |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 4,4,6-trimethyl-2-oxoheptanoyl chloride |
| SMILES | CC(C)CC(C)(C)CC(=O)C(=O)Cl |
| InChI | InChI=1S/C10H17ClO2/c1-7(2)5-10(3,4)6-8(12)9(11)13/h7H,5-6H2,1-4H3 |
| InChIKey | YYHBYVOAXCLHBJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|