About 5,5,7-trimethyloctan-3-yl nitrate
5,5,7-trimethyloctan-3-yl nitrate (PubChem CID 58209365) has the molecular formula C11H23NO3
and a molecular weight of 217.31 g/mol. Its IUPAC name is 5,5,7-trimethyloctan-3-yl nitrate.
Molecular Properties
| Compound Name | 5,5,7-trimethyloctan-3-yl nitrate |
| PubChem CID | 58209365 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | 5,5,7-trimethyloctan-3-yl nitrate |
| SMILES | CCC(CC(C)(C)CC(C)C)O[N+](=O)[O-] |
| InChI | InChI=1S/C11H23NO3/c1-6-10(15-12(13)14)8-11(4,5)7-9(2)3/h9-10H,6-8H2,1-5H3 |
| InChIKey | QXUNWDVENJJNQO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,5,7-trimethyloctan-3-yl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5,7-trimethyloctan-3-yl nitrate?
The IUPAC name of 5,5,7-trimethyloctan-3-yl nitrate (CID 58209365) is 5,5,7-trimethyloctan-3-yl nitrate.
What is the SMILES notation for 5,5,7-trimethyloctan-3-yl nitrate?
The canonical SMILES for 5,5,7-trimethyloctan-3-yl nitrate is CCC(CC(C)(C)CC(C)C)O[N+](=O)[O-].
What is the InChIKey of 5,5,7-trimethyloctan-3-yl nitrate?
The InChIKey is QXUNWDVENJJNQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO3/c1-6-10(15-12(13)14)8-11(4,5)7-9(2)3/h9-10H,6-8H2,1-5H3.
What are the key properties of 5,5,7-trimethyloctan-3-yl nitrate?
5,5,7-trimethyloctan-3-yl nitrate has a molecular weight of 217.31 g/mol, XLogP of 3.44, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5,7-trimethyloctan-3-yl nitrate is sourced from PubChem (CID 58209365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).