About 5-nitrooxyheptanoic acid
5-nitrooxyheptanoic acid (PubChem CID 76703184) has the molecular formula C7H13NO5
and a molecular weight of 191.18 g/mol. Its IUPAC name is 5-nitrooxyheptanoic acid.
Molecular Properties
| Compound Name | 5-nitrooxyheptanoic acid |
| PubChem CID | 76703184 |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 5-nitrooxyheptanoic acid |
| SMILES | CCC(CCCC(=O)O)O[N+](=O)[O-] |
| InChI | InChI=1S/C7H13NO5/c1-2-6(13-8(11)12)4-3-5-7(9)10/h6H,2-5H2,1H3,(H,9,10) |
| InChIKey | XVPFXYVXMZXIMY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitrooxyheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitrooxyheptanoic acid?
The IUPAC name of 5-nitrooxyheptanoic acid (CID 76703184) is 5-nitrooxyheptanoic acid.
What is the SMILES notation for 5-nitrooxyheptanoic acid?
The canonical SMILES for 5-nitrooxyheptanoic acid is CCC(CCCC(=O)O)O[N+](=O)[O-].
What is the InChIKey of 5-nitrooxyheptanoic acid?
The InChIKey is XVPFXYVXMZXIMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO5/c1-2-6(13-8(11)12)4-3-5-7(9)10/h6H,2-5H2,1H3,(H,9,10).
What are the key properties of 5-nitrooxyheptanoic acid?
5-nitrooxyheptanoic acid has a molecular weight of 191.18 g/mol, XLogP of 1.23, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitrooxyheptanoic acid is sourced from PubChem (CID 76703184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).