About 7-nitrooxy-3-oxooctanoic acid
7-nitrooxy-3-oxooctanoic acid (PubChem CID 87498204) has the molecular formula C8H13NO6
and a molecular weight of 219.19 g/mol. Its IUPAC name is 7-nitrooxy-3-oxooctanoic acid.
Molecular Properties
| Compound Name | 7-nitrooxy-3-oxooctanoic acid |
| PubChem CID | 87498204 |
| Molecular Formula | C8H13NO6 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 7-nitrooxy-3-oxooctanoic acid |
| SMILES | CC(CCCC(=O)CC(=O)O)O[N+](=O)[O-] |
| InChI | InChI=1S/C8H13NO6/c1-6(15-9(13)14)3-2-4-7(10)5-8(11)12/h6H,2-5H2,1H3,(H,11,12) |
| InChIKey | HUQUKYJWCGSRPV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitrooxy-3-oxooctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitrooxy-3-oxooctanoic acid?
The IUPAC name of 7-nitrooxy-3-oxooctanoic acid (CID 87498204) is 7-nitrooxy-3-oxooctanoic acid.
What is the SMILES notation for 7-nitrooxy-3-oxooctanoic acid?
The canonical SMILES for 7-nitrooxy-3-oxooctanoic acid is CC(CCCC(=O)CC(=O)O)O[N+](=O)[O-].
What is the InChIKey of 7-nitrooxy-3-oxooctanoic acid?
The InChIKey is HUQUKYJWCGSRPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO6/c1-6(15-9(13)14)3-2-4-7(10)5-8(11)12/h6H,2-5H2,1H3,(H,11,12).
What are the key properties of 7-nitrooxy-3-oxooctanoic acid?
7-nitrooxy-3-oxooctanoic acid has a molecular weight of 219.19 g/mol, XLogP of 0.80, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitrooxy-3-oxooctanoic acid is sourced from PubChem (CID 87498204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).