C9H15N3O9 — CID 140866890
3-[[(5S)-5,6-dinitrooxyhexanoyl]amino]propanoic acid (PubChem CID 140866890) has the molecular formula C9H15N3O9 and a molecular weight of 309.23 g/mol. Its IUPAC name is 3-[[(5S)-5,6-dinitrooxyhexanoyl]amino]propanoic acid.
| Compound Name | 3-[[(5S)-5,6-dinitrooxyhexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 140866890 |
| Molecular Formula | C9H15N3O9 |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3-[[(5S)-5,6-dinitrooxyhexanoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)CCC[C@@H](CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C9H15N3O9/c13-8(10-5-4-9(14)15)3-1-2-7(21-12(18)19)6-20-11(16)17/h7H,1-6H2,(H,10,13)(H,14,15)/t7-/m0/s1 |
| InChIKey | OBOUMIHVNHODNT-ZETCQYMHSA-N |
| XLogP | -0.47 |
| TPSA | 171.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|