C12H21N3O10 — CID 160941839
2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid (PubChem CID 160941839) has the molecular formula C12H21N3O10 and a molecular weight of 367.31 g/mol. Its IUPAC name is 2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid.
| Compound Name | 2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid |
|---|---|
| PubChem CID | 160941839 |
| Molecular Formula | C12H21N3O10 |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid |
| SMILES | CC(OC(=O)CCCCCC(CO[N+](=O)[O-])O[N+](=O)[O-])C(N)C(=O)O |
| InChI | InChI=1S/C12H21N3O10/c1-8(11(13)12(17)18)24-10(16)6-4-2-3-5-9(25-15(21)22)7-23-14(19)20/h8-9,11H,2-7,13H2,1H3,(H,17,18) |
| InChIKey | MNDYBKBVMWITBN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 194.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|