2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid

C12H21N3O10 — CID 160941839

IUPAC2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid
SMILESCC(OC(=O)CCCCCC(CO[N+](=O)[O-])O[N+](=O)[O-])C(N)C(=O)O
InChIInChI=1S/C12H21N3O10/c1-8(11(13)12(17)18)24-10(16)6-4-2-3-5-9(25-15(21)22)7-23-14(19)20/h8-9,11H,2-7,13H2,1H3,(H,17,18)
InChIKeyMNDYBKBVMWITBN-UHFFFAOYSA-N
MW367.31 g/mol
LogP0.07
Rot. Bonds14

About 2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid

2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid (PubChem CID 160941839) has the molecular formula C12H21N3O10 and a molecular weight of 367.31 g/mol. Its IUPAC name is 2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid.

Molecular Properties

Compound Name2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid
PubChem CID160941839
Molecular FormulaC12H21N3O10
Molecular Weight367.31 g/mol
Exact Mass367.12
IUPAC Name2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid
SMILESCC(OC(=O)CCCCCC(CO[N+](=O)[O-])O[N+](=O)[O-])C(N)C(=O)O
InChIInChI=1S/C12H21N3O10/c1-8(11(13)12(17)18)24-10(16)6-4-2-3-5-9(25-15(21)22)7-23-14(19)20/h8-9,11H,2-7,13H2,1H3,(H,17,18)
InChIKeyMNDYBKBVMWITBN-UHFFFAOYSA-N
XLogP0.07
TPSA194.36 Ų
H-Bond Donors2
H-Bond Acceptors10
Rotatable Bonds14
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500367.31
LogP ≤ 50.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 1010

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid?
The IUPAC name of 2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid (CID 160941839) is 2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid.
What is the SMILES notation for 2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid?
The canonical SMILES for 2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid is CC(OC(=O)CCCCCC(CO[N+](=O)[O-])O[N+](=O)[O-])C(N)C(=O)O.
What is the InChIKey of 2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid?
The InChIKey is MNDYBKBVMWITBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O10/c1-8(11(13)12(17)18)24-10(16)6-4-2-3-5-9(25-15(21)22)7-23-14(19)20/h8-9,11H,2-7,13H2,1H3,(H,17,18).
What are the key properties of 2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid?
2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid has a molecular weight of 367.31 g/mol, XLogP of 0.07, 14 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(7,8-dinitrooxyoctanoyloxy)butanoic acid is sourced from PubChem (CID 160941839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).