About 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate
1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate (PubChem CID 141204995) has the molecular formula C13H17N3O10
and a molecular weight of 375.29 g/mol. Its IUPAC name is 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate |
| PubChem CID | 141204995 |
| Molecular Formula | C13H17N3O10 |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate |
| SMILES | CC(OC(=O)CCC[C@H](CO[N+](=O)[O-])O[N+](=O)[O-])OC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C13H17N3O10/c1-9(25-13(18)11-5-3-7-14-11)24-12(17)6-2-4-10(26-16(21)22)8-23-15(19)20/h3,5,7,9-10,14H,2,4,6,8H2,1H3/t9?,10-/m1/s1 |
| InChIKey | OFIAPYRNRCBGLY-QVDQXJPCSA-N |
| XLogP | 1.02 |
| TPSA | 173.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate?
The IUPAC name of 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate (CID 141204995) is 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate.
What is the SMILES notation for 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate?
The canonical SMILES for 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate is CC(OC(=O)CCC[C@H](CO[N+](=O)[O-])O[N+](=O)[O-])OC(=O)c1ccc[nH]1.
What is the InChIKey of 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate?
The InChIKey is OFIAPYRNRCBGLY-QVDQXJPCSA-N. The full InChI is InChI=1S/C13H17N3O10/c1-9(25-13(18)11-5-3-7-14-11)24-12(17)6-2-4-10(26-16(21)22)8-23-15(19)20/h3,5,7,9-10,14H,2,4,6,8H2,1H3/t9?,10-/m1/s1.
What are the key properties of 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate?
1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate has a molecular weight of 375.29 g/mol, XLogP of 1.02, 12 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate is sourced from PubChem (CID 141204995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).