C13H17N3O10 — CID 141204995
1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate (PubChem CID 141204995) has the molecular formula C13H17N3O10 and a molecular weight of 375.29 g/mol. Its IUPAC name is 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate.
| Compound Name | 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 141204995 |
| Molecular Formula | C13H17N3O10 |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-[(5R)-5,6-dinitrooxyhexanoyl]oxyethyl 1H-pyrrole-2-carboxylate |
| SMILES | CC(OC(=O)CCC[C@H](CO[N+](=O)[O-])O[N+](=O)[O-])OC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C13H17N3O10/c1-9(25-13(18)11-5-3-7-14-11)24-12(17)6-2-4-10(26-16(21)22)8-23-15(19)20/h3,5,7,9-10,14H,2,4,6,8H2,1H3/t9?,10-/m1/s1 |
| InChIKey | OFIAPYRNRCBGLY-QVDQXJPCSA-N |
| XLogP | 1.02 |
| TPSA | 173.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|