C9H15Cl3N2O8Zn — CID 158644185
zinc;[(5R)-1-chloro-5,6-dinitrooxyhexyl] propanoate;dichloride (PubChem CID 158644185) has the molecular formula C9H15Cl3N2O8Zn and a molecular weight of 450.97 g/mol. Its IUPAC name is zinc;[(5R)-1-chloro-5,6-dinitrooxyhexyl] propanoate;dichloride.
| Compound Name | zinc;[(5R)-1-chloro-5,6-dinitrooxyhexyl] propanoate;dichloride |
|---|---|
| PubChem CID | 158644185 |
| Molecular Formula | C9H15Cl3N2O8Zn |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 447.92 |
| IUPAC Name | zinc;[(5R)-1-chloro-5,6-dinitrooxyhexyl] propanoate;dichloride |
| SMILES | CCC(=O)OC(Cl)CCC[C@H](CO[N+](=O)[O-])O[N+](=O)[O-].[Cl-].[Cl-].[Zn+2] |
| InChI | InChI=1S/C9H15ClN2O8.2ClH.Zn/c1-2-9(13)19-8(10)5-3-4-7(20-12(16)17)6-18-11(14)15;;;/h7-8H,2-6H2,1H3;2*1H;/q;;;+2/p-2/t7-,8?;;;/m1.../s1 |
| InChIKey | IATKDBSBTGNEJR-RKCXTWHASA-L |
| XLogP | -4.53 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|