C6H14N2O13P2 — CID 11485914
(1-hydroxy-5,6-dinitrooxy-1-phosphonohexyl)phosphonic acid (PubChem CID 11485914) has the molecular formula C6H14N2O13P2 and a molecular weight of 384.13 g/mol. Its IUPAC name is (1-hydroxy-5,6-dinitrooxy-1-phosphonohexyl)phosphonic acid.
| Compound Name | (1-hydroxy-5,6-dinitrooxy-1-phosphonohexyl)phosphonic acid |
|---|---|
| PubChem CID | 11485914 |
| Molecular Formula | C6H14N2O13P2 |
| Molecular Weight | 384.13 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | (1-hydroxy-5,6-dinitrooxy-1-phosphonohexyl)phosphonic acid |
| SMILES | O=[N+]([O-])OCC(CCCC(O)(P(=O)(O)O)P(=O)(O)O)O[N+](=O)[O-] |
| InChI | InChI=1S/C6H14N2O13P2/c9-6(22(14,15)16,23(17,18)19)3-1-2-5(21-8(12)13)4-20-7(10)11/h5,9H,1-4H2,(H2,14,15,16)(H2,17,18,19) |
| InChIKey | PUCBWHIJRAWDRD-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 240.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.13 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|