C9H16N2O9 — CID 123194109
[(5R)-5,6-dinitrooxyhexyl] ethyl carbonate (PubChem CID 123194109) has the molecular formula C9H16N2O9 and a molecular weight of 296.23 g/mol. Its IUPAC name is [(5R)-5,6-dinitrooxyhexyl] ethyl carbonate.
| Compound Name | [(5R)-5,6-dinitrooxyhexyl] ethyl carbonate |
|---|---|
| PubChem CID | 123194109 |
| Molecular Formula | C9H16N2O9 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | [(5R)-5,6-dinitrooxyhexyl] ethyl carbonate |
| SMILES | CCOC(=O)OCCCC[C@H](CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N2O9/c1-2-17-9(12)18-6-4-3-5-8(20-11(15)16)7-19-10(13)14/h8H,2-7H2,1H3/t8-/m1/s1 |
| InChIKey | QNVSWAWOLZFGPQ-MRVPVSSYSA-N |
| XLogP | 1.12 |
| TPSA | 140.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|