C28H32N4O10 — CID 76639757
5,6-dinitrooxyhexyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate (PubChem CID 76639757) has the molecular formula C28H32N4O10 and a molecular weight of 584.58 g/mol. Its IUPAC name is 5,6-dinitrooxyhexyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate.
| Compound Name | 5,6-dinitrooxyhexyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 76639757 |
| Molecular Formula | C28H32N4O10 |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | 5,6-dinitrooxyhexyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate |
| SMILES | COC(c1ccccc1)(c1ccccc1)C(Oc1nc(C)cc(C)n1)C(=O)OCCCCC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C28H32N4O10/c1-20-18-21(2)30-27(29-20)41-25(26(33)39-17-11-10-16-24(42-32(36)37)19-40-31(34)35)28(38-3,22-12-6-4-7-13-22)23-14-8-5-9-15-23/h4-9,12-15,18,24-25H,10-11,16-17,19H2,1-3H3 |
| InChIKey | VBGIHVUSWCVBBK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 175.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|