C25H29N3O9 — CID 89145041
3-(dihydroxyamino)oxypropyl (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate (PubChem CID 89145041) has the molecular formula C25H29N3O9 and a molecular weight of 515.52 g/mol. Its IUPAC name is 3-(dihydroxyamino)oxypropyl (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate.
| Compound Name | 3-(dihydroxyamino)oxypropyl (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 89145041 |
| Molecular Formula | C25H29N3O9 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 3-(dihydroxyamino)oxypropyl (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate |
| SMILES | COc1cc(OC)nc(O[C@H](C(=O)OCCCON(O)O)C(OC)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C25H29N3O9/c1-32-20-17-21(33-2)27-24(26-20)37-22(23(29)35-15-10-16-36-28(30)31)25(34-3,18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-9,11-14,17,22,30-31H,10,15-16H2,1-3H3/t22-/m1/s1 |
| InChIKey | MQISEEPTPCXLKW-JOCHJYFZSA-N |
| XLogP | 2.78 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|