C28H33N3O9 — CID 25093985
6-nitrooxyhexyl (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate (PubChem CID 25093985) has the molecular formula C28H33N3O9 and a molecular weight of 555.58 g/mol. Its IUPAC name is 6-nitrooxyhexyl (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate.
| Compound Name | 6-nitrooxyhexyl (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 25093985 |
| Molecular Formula | C28H33N3O9 |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 6-nitrooxyhexyl (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate |
| SMILES | COc1cc(OC)nc(O[C@H](C(=O)OCCCCCCO[N+](=O)[O-])C(OC)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C28H33N3O9/c1-35-23-20-24(36-2)30-27(29-23)40-25(26(32)38-18-12-4-5-13-19-39-31(33)34)28(37-3,21-14-8-6-9-15-21)22-16-10-7-11-17-22/h6-11,14-17,20,25H,4-5,12-13,18-19H2,1-3H3/t25-/m1/s1 |
| InChIKey | DTUQWPKXXARUOV-RUZDIDTESA-N |
| XLogP | 4.14 |
| TPSA | 141.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|