C26H29N3O9 — CID 143585440
4-nitrooxybutyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate (PubChem CID 143585440) has the molecular formula C26H29N3O9 and a molecular weight of 527.53 g/mol. Its IUPAC name is 4-nitrooxybutyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate.
| Compound Name | 4-nitrooxybutyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 143585440 |
| Molecular Formula | C26H29N3O9 |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 4-nitrooxybutyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate |
| SMILES | COc1cc(OC)nc(OC(C(=O)OCCCCO[N+](=O)[O-])C(OC)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C26H29N3O9/c1-33-21-18-22(34-2)28-25(27-21)38-23(24(30)36-16-10-11-17-37-29(31)32)26(35-3,19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-9,12-15,18,23H,10-11,16-17H2,1-3H3 |
| InChIKey | YKVCYYDQTFPDFZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 141.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|