C28H33N3O7 — CID 76639746
6-nitrooxyhexyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate (PubChem CID 76639746) has the molecular formula C28H33N3O7 and a molecular weight of 523.59 g/mol. Its IUPAC name is 6-nitrooxyhexyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate.
| Compound Name | 6-nitrooxyhexyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 76639746 |
| Molecular Formula | C28H33N3O7 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 6-nitrooxyhexyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate |
| SMILES | COC(c1ccccc1)(c1ccccc1)C(Oc1nc(C)cc(C)n1)C(=O)OCCCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C28H33N3O7/c1-21-20-22(2)30-27(29-21)38-25(26(32)36-18-12-4-5-13-19-37-31(33)34)28(35-3,23-14-8-6-9-15-23)24-16-10-7-11-17-24/h6-11,14-17,20,25H,4-5,12-13,18-19H2,1-3H3 |
| InChIKey | XONGWDPMWAAVEO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 122.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|