About methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate
methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate (PubChem CID 46892088) has the molecular formula C24H25NO6
and a molecular weight of 423.47 g/mol. Its IUPAC name is methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate.
Molecular Properties
| Compound Name | methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate |
| PubChem CID | 46892088 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate |
| SMILES | COC(=O)C(Oc1cc(OC)nc(OC)c1)C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NO6/c1-27-20-15-19(16-21(25-20)28-2)31-22(23(26)29-3)24(30-4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-16,22H,1-4H3 |
| InChIKey | BCNOVYXZBLNYFJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate?
The IUPAC name of methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate (CID 46892088) is methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate.
What is the SMILES notation for methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate?
The canonical SMILES for methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate is COC(=O)C(Oc1cc(OC)nc(OC)c1)C(OC)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate?
The InChIKey is BCNOVYXZBLNYFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25NO6/c1-27-20-15-19(16-21(25-20)28-2)31-22(23(26)29-3)24(30-4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-16,22H,1-4H3.
What are the key properties of methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate?
methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate has a molecular weight of 423.47 g/mol, XLogP of 3.61, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,6-dimethoxy-4-pyridinyl)oxy]-3-methoxy-3,3-diphenylpropanoate is sourced from PubChem (CID 46892088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).