C23H34N2O13 — CID 118438283
[10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-12,13-dinitrooxytridecyl] hydrogen carbonate (PubChem CID 118438283) has the molecular formula C23H34N2O13 and a molecular weight of 546.53 g/mol. Its IUPAC name is [10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-12,13-dinitrooxytridecyl] hydrogen carbonate.
| Compound Name | [10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-12,13-dinitrooxytridecyl] hydrogen carbonate |
|---|---|
| PubChem CID | 118438283 |
| Molecular Formula | C23H34N2O13 |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | [10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-12,13-dinitrooxytridecyl] hydrogen carbonate |
| SMILES | COC1=C(OC)C(=O)C(C(CCCCCCCCCOC(=O)O)CC(CO[N+](=O)[O-])O[N+](=O)[O-])=C(C)C1=O |
| InChI | InChI=1S/C23H34N2O13/c1-15-18(20(27)22(35-3)21(34-2)19(15)26)16(13-17(38-25(32)33)14-37-24(30)31)11-9-7-5-4-6-8-10-12-36-23(28)29/h16-17H,4-14H2,1-3H3,(H,28,29) |
| InChIKey | WGEPCGZGSQAPRA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 203.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|