C16H21NO9 — CID 118438222
3-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)propyl 4-nitrooxybutanoate (PubChem CID 118438222) has the molecular formula C16H21NO9 and a molecular weight of 371.34 g/mol. Its IUPAC name is 3-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)propyl 4-nitrooxybutanoate.
| Compound Name | 3-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)propyl 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 118438222 |
| Molecular Formula | C16H21NO9 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 3-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)propyl 4-nitrooxybutanoate |
| SMILES | COC1=C(OC)C(=O)C(CCCOC(=O)CCCO[N+](=O)[O-])=C(C)C1=O |
| InChI | InChI=1S/C16H21NO9/c1-10-11(14(20)16(24-3)15(23-2)13(10)19)6-4-8-25-12(18)7-5-9-26-17(21)22/h4-9H2,1-3H3 |
| InChIKey | NRUMTURYXLUKGD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 131.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|