C25H33NO9 — CID 144733134
ethane;4-nitrooxybutyl 4-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-4-phenylbutanoate (PubChem CID 144733134) has the molecular formula C25H33NO9 and a molecular weight of 491.54 g/mol. Its IUPAC name is ethane;4-nitrooxybutyl 4-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-4-phenylbutanoate.
| Compound Name | ethane;4-nitrooxybutyl 4-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-4-phenylbutanoate |
|---|---|
| PubChem CID | 144733134 |
| Molecular Formula | C25H33NO9 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | ethane;4-nitrooxybutyl 4-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-4-phenylbutanoate |
| SMILES | CC.COC1=C(OC)C(=O)C(C(CCC(=O)OCCCCO[N+](=O)[O-])c2ccccc2)=C(C)C1=O |
| InChI | InChI=1S/C23H27NO9.C2H6/c1-15-19(21(27)23(31-3)22(30-2)20(15)26)17(16-9-5-4-6-10-16)11-12-18(25)32-13-7-8-14-33-24(28)29;1-2/h4-6,9-10,17H,7-8,11-14H2,1-3H3;1-2H3 |
| InChIKey | QGGHSZHPHVESRV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 131.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|