C30H42N2O7 — CID 10152853
[3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(2-methylpropanoyloxy)phenyl]methyl 4-nitrooxybutanoate (PubChem CID 10152853) has the molecular formula C30H42N2O7 and a molecular weight of 542.67 g/mol. Its IUPAC name is [3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(2-methylpropanoyloxy)phenyl]methyl 4-nitrooxybutanoate.
| Compound Name | [3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(2-methylpropanoyloxy)phenyl]methyl 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 10152853 |
| Molecular Formula | C30H42N2O7 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | [3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(2-methylpropanoyloxy)phenyl]methyl 4-nitrooxybutanoate |
| SMILES | CC(C)C(=O)Oc1ccc(COC(=O)CCCO[N+](=O)[O-])cc1[C@H](CCN(C(C)C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C30H42N2O7/c1-21(2)30(34)39-28-15-14-24(20-37-29(33)13-10-18-38-32(35)36)19-27(28)26(25-11-8-7-9-12-25)16-17-31(22(3)4)23(5)6/h7-9,11-12,14-15,19,21-23,26H,10,13,16-18,20H2,1-6H3/t26-/m1/s1 |
| InChIKey | VGHWSRHCHHTQSR-AREMUKBSSA-N |
| XLogP | 5.92 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|