C26H35NO6 — CID 24805247
(3R)-4-[2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenoxy]-2,3-dihydroxy-4-oxobutanoic acid (PubChem CID 24805247) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is (3R)-4-[2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenoxy]-2,3-dihydroxy-4-oxobutanoic acid.
| Compound Name | (3R)-4-[2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenoxy]-2,3-dihydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 24805247 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | (3R)-4-[2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenoxy]-2,3-dihydroxy-4-oxobutanoic acid |
| SMILES | Cc1ccc(OC(=O)[C@H](O)C(O)C(=O)O)c(C(CCN(C(C)C)C(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C26H35NO6/c1-16(2)27(17(3)4)14-13-20(19-9-7-6-8-10-19)21-15-18(5)11-12-22(21)33-26(32)24(29)23(28)25(30)31/h6-12,15-17,20,23-24,28-29H,13-14H2,1-5H3,(H,30,31)/t20?,23?,24-/m1/s1 |
| InChIKey | DMBUUCXLORAHIV-VZYOYLOZSA-N |
| XLogP | 3.35 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|