C26H38ClNO2 — CID 69133569
[2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenyl] butanoate;hydrochloride (PubChem CID 69133569) has the molecular formula C26H38ClNO2 and a molecular weight of 432.05 g/mol. Its IUPAC name is [2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenyl] butanoate;hydrochloride.
| Compound Name | [2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenyl] butanoate;hydrochloride |
|---|---|
| PubChem CID | 69133569 |
| Molecular Formula | C26H38ClNO2 |
| Molecular Weight | 432.05 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | [2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenyl] butanoate;hydrochloride |
| SMILES | CCCC(=O)Oc1ccc(C)cc1[C@H](CCN(C(C)C)C(C)C)c1ccccc1.Cl |
| InChI | InChI=1S/C26H37NO2.ClH/c1-7-11-26(28)29-25-15-14-21(6)18-24(25)23(22-12-9-8-10-13-22)16-17-27(19(2)3)20(4)5;/h8-10,12-15,18-20,23H,7,11,16-17H2,1-6H3;1H/t23-;/m1./s1 |
| InChIKey | BONCVKSUCCIYFD-GNAFDRTKSA-N |
| XLogP | 6.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.05 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|