C29H44ClNO3 — CID 142655418
[2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxy-3-methylphenyl] heptanoate;hydrochloride (PubChem CID 142655418) has the molecular formula C29H44ClNO3 and a molecular weight of 490.13 g/mol. Its IUPAC name is [2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxy-3-methylphenyl] heptanoate;hydrochloride.
| Compound Name | [2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxy-3-methylphenyl] heptanoate;hydrochloride |
|---|---|
| PubChem CID | 142655418 |
| Molecular Formula | C29H44ClNO3 |
| Molecular Weight | 490.13 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | [2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxy-3-methylphenyl] heptanoate;hydrochloride |
| SMILES | CCCCCCC(=O)Oc1ccc(O)c(C)c1C(CCN(C(C)C)C(C)C)c1ccccc1.Cl |
| InChI | InChI=1S/C29H43NO3.ClH/c1-7-8-9-13-16-28(32)33-27-18-17-26(31)23(6)29(27)25(24-14-11-10-12-15-24)19-20-30(21(2)3)22(4)5;/h10-12,14-15,17-18,21-22,25,31H,7-9,13,16,19-20H2,1-6H3;1H |
| InChIKey | BHJLIYMUFPRVHZ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.13 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|