C28H44NO2Si — CID 70182718
CID 70182718 (PubChem CID 70182718) has the molecular formula C28H44NO2Si and a molecular weight of 454.75 g/mol.
| Compound Name | CID 70182718 |
|---|---|
| PubChem CID | 70182718 |
| Molecular Formula | C28H44NO2Si |
| Molecular Weight | 454.75 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | — |
| SMILES | CCCCC(O[Si](C)C)c1cccc(O)c1C(CCN(C(C)C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H44NO2Si/c1-8-9-18-27(31-32(6)7)25-16-13-17-26(30)28(25)24(23-14-11-10-12-15-23)19-20-29(21(2)3)22(4)5/h10-17,21-22,24,27,30H,8-9,18-20H2,1-7H3 |
| InChIKey | WINMUYGKNRHPFA-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.75 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|