C23H33NO — CID 22677023
2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-ethylphenol (PubChem CID 22677023) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is 2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-ethylphenol.
| Compound Name | 2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-ethylphenol |
|---|---|
| PubChem CID | 22677023 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-ethylphenol |
| SMILES | CCc1ccc(O)c(C(CCN(C(C)C)C(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C23H33NO/c1-6-19-12-13-23(25)22(16-19)21(20-10-8-7-9-11-20)14-15-24(17(2)3)18(4)5/h7-13,16-18,21,25H,6,14-15H2,1-5H3 |
| InChIKey | SRQMMEXZKKLKPL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |