C24H32N2O — CID 18357318
3-[3-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxyphenyl]propanenitrile (PubChem CID 18357318) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is 3-[3-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxyphenyl]propanenitrile.
| Compound Name | 3-[3-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxyphenyl]propanenitrile |
|---|---|
| PubChem CID | 18357318 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 3-[3-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxyphenyl]propanenitrile |
| SMILES | CC(C)N(CCC(c1ccccc1)c1cc(CCC#N)ccc1O)C(C)C |
| InChI | InChI=1S/C24H32N2O/c1-18(2)26(19(3)4)16-14-22(21-10-6-5-7-11-21)23-17-20(9-8-15-25)12-13-24(23)27/h5-7,10-13,17-19,22,27H,8-9,14,16H2,1-4H3 |
| InChIKey | RYBZMVRTONWJJF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |